Boc-D-His(Bom)-OH structure
|
Common Name | Boc-D-His(Bom)-OH | ||
|---|---|---|---|---|
| CAS Number | 99310-01-7 | Molecular Weight | 375.419 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 595.3±50.0 °C at 760 mmHg | |
| Molecular Formula | C19H25N3O5 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 313.8±30.1 °C | |
| Name | Boc-D-His(Bom)-OH |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 595.3±50.0 °C at 760 mmHg |
| Molecular Formula | C19H25N3O5 |
| Molecular Weight | 375.419 |
| Flash Point | 313.8±30.1 °C |
| Exact Mass | 375.179413 |
| PSA | 102.68000 |
| LogP | 2.26 |
| Appearance of Characters | Powder | White to off-white |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.563 |
| InChIKey | LPVKZCHCZSFTOJ-MRXNPFEDSA-N |
| SMILES | CC(C)(C)OC(=O)NC(Cc1cncn1COCc1ccccc1)C(=O)O |
| Storage condition | -15°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[3-(phenylmethoxymethyl)imidazol-4-yl]propanoic acid |
| 3-[(Benzyloxy)methyl]-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-D-histidine |
| D-Histidine, N-[(1,1-dimethylethoxy)carbonyl]-3-[(phenylmethoxy)methyl]- |