[3-(cyclohexylidenemethylidene)-2-ethylpent-1-enylidene]cyclohexane structure
|
Common Name | [3-(cyclohexylidenemethylidene)-2-ethylpent-1-enylidene]cyclohexane | ||
|---|---|---|---|---|
| CAS Number | 99413-17-9 | Molecular Weight | 270.45200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H30 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [3-(cyclohexylidenemethylidene)-2-ethylpent-1-enylidene]cyclohexane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H30 |
|---|---|
| Molecular Weight | 270.45200 |
| Exact Mass | 270.23500 |
| LogP | 6.63800 |
| InChIKey | VRTDLVTWBYDASA-UHFFFAOYSA-N |
| SMILES | CCC(=C=C1CCCCC1)C(=C=C1CCCCC1)CC |
|
~88%
[3-(cyclohexyli... CAS#:99413-17-9 |
| Literature: Tolstikov, G. A.; Romanova, T. Yu.; Kuchin, A. V. Journal of Organometallic Chemistry, 1985 , vol. 285, p. 71 - 82 |
|
~%
[3-(cyclohexyli... CAS#:99413-17-9 |
| Literature: Tolstikov, G. A.; Romanova, T. Yu.; Kuchin, A. V. Journal of Organometallic Chemistry, 1985 , vol. 285, p. 71 - 82 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,1,6,6-dipentamethylene-5,6-diethyl-1,2,4,5-hexatetraene |
| 1,1,6,6-dipentamethylene-3,4-diethyl-1,2,4,5-hexatetraene |
| Cyclohexane,1,1'-(2,3-diethyl-1,3-butadiene-1,4-diylidene)bis |