Methyl 3-Amino-4-nitrobenzoate structure
|
Common Name | Methyl 3-Amino-4-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 99512-09-1 | Molecular Weight | 196.160 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 394.1±27.0 °C at 760 mmHg | |
| Molecular Formula | C8H8N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.2±23.7 °C | |
| Name | Methyl 3-amino-4-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 394.1±27.0 °C at 760 mmHg |
| Molecular Formula | C8H8N2O4 |
| Molecular Weight | 196.160 |
| Flash Point | 192.2±23.7 °C |
| Exact Mass | 196.048401 |
| PSA | 98.14000 |
| LogP | 1.78 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.606 |
| InChIKey | ZGVYPBINPLNBDH-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc([N+](=O)[O-])c(N)c1 |
| HS Code | 2922499990 |
|---|
|
~%
Methyl 3-Amino-... CAS#:99512-09-1 |
| Literature: Journal of the Chemical Society - Perkin Transactions 1, , # 19 p. 2759 - 2770 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Benzoic acid, 3-amino-4-nitro-, methyl ester |
| Methyl 3-amino-4-nitrobenzoate |
| 2-nitro-5-methoxycarbonylaniline |
| methylaminonitrobenzoate |
| methyl-3-amino-4-nitrobenzoate |
| Benzoic acid,3-amino-4-nitro-,methyl ester |