Eucalyptosin A
Modify Date: 2025-09-09 17:30:47
Eucalyptosin A structure
|
Common Name | Eucalyptosin A | ||
|---|---|---|---|---|
| CAS Number | 99520-78-2 | Molecular Weight | 457.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H27NO11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Eucalyptosin A |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H27NO11 |
|---|---|
| Molecular Weight | 457.4 |
| InChIKey | YGHHWSRCTPQFFC-YSCNKMLASA-N |
| SMILES | N#CC(OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1O)c1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 99520-78-2? |
| A: Chinese name of 99520-78-2 is 99520-78-2. |
| Q: What is the English name of Eucalyptosin A? |
| A: The English name of Eucalyptosin A is Eucalyptosin A. |
| Q: What is the molecular weight of Eucalyptosin A? |
| A: Molecular weight of Eucalyptosin A is 457.4. |
| Q: What is the CAS number of Eucalyptosin A? |
| A: CAS number of Eucalyptosin A is 99520-78-2. |
| Q: What is the molecular formula of Eucalyptosin A? |
| A: Molecular formula of Eucalyptosin A is C20H27NO11. |
| Q: What is the InChIKey of Eucalyptosin A? |
| A: InChIKey of Eucalyptosin A is YGHHWSRCTPQFFC-YSCNKMLASA-N. |
| Q: What is the SMILES notation of Eucalyptosin A? |
| A: SMILES notation of Eucalyptosin A is N#CC(OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1O)c1ccccc1. |