1-[1-(benzenesulfonyl)-6-methoxyindol-3-yl]ethanone structure
|
Common Name | 1-[1-(benzenesulfonyl)-6-methoxyindol-3-yl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 99532-46-4 | Molecular Weight | 329.37000 | |
| Density | 1.298g/cm3 | Boiling Point | 540.004ºC at 760 mmHg | |
| Molecular Formula | C17H15NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 280.385ºC | |
| Name | 1-[1-(benzenesulfonyl)-6-methoxyindol-3-yl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.298g/cm3 |
|---|---|
| Boiling Point | 540.004ºC at 760 mmHg |
| Molecular Formula | C17H15NO4S |
| Molecular Weight | 329.37000 |
| Flash Point | 280.385ºC |
| Exact Mass | 329.07200 |
| PSA | 73.75000 |
| LogP | 4.17030 |
| Index of Refraction | 1.617 |
| InChIKey | OMSLVVFDGZDEIX-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(C(C)=O)cn(S(=O)(=O)c3ccccc3)c2c1 |
| HS Code | 2933990090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(6-Methoxy-1-(phenylsulfonyl)-1H-indol-3-yl)ethanone |
| 3-acetyl-6-methoxy-1-(phenylsulfonyl)indole |