EGTA-AM
Modify Date: 2026-07-14 10:34:13
EGTA-AM structure
|
Common Name | EGTA-AM | ||
|---|---|---|---|---|
| CAS Number | 99590-86-0 | Molecular Weight | 668.59800 | |
| Density | 1.303g/cm3 | Boiling Point | 664.2ºC at 760 mmHg | |
| Molecular Formula | C26H40N2O18 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 355.5ºC | |
Use of EGTA-AMEGTA-AM is a membrane permeable form of EGTA, can be passively loaded into cells to generate intracellular EGTA; EGTA-AM is also a Ca2+ chelator with slow chelating dynamics. |
| Name | acetyloxymethyl 2-[[2-(acetyloxymethoxy)-2-oxoethyl]-[2-[2-[2-[bis[2-(acetyloxymethoxy)-2-oxoethyl]amino]ethoxy]ethoxy]ethyl]amino]acetate |
|---|---|
| Synonym | More Synonyms |
| Description | EGTA-AM is a membrane permeable form of EGTA, can be passively loaded into cells to generate intracellular EGTA; EGTA-AM is also a Ca2+ chelator with slow chelating dynamics. |
|---|---|
| Related Catalog | |
| In Vitro | EGTA-AM (50 μM) markedly reduces the asynchronous excitatory postsynaptic currents (aEPSC) to 58.9 ± 8.1% of the control level, but only reduces the synchronous excitatory postsynaptic currents (EPSCs), measured as charge transfer produced by the stimulation train[1]. |
| References |
| Density | 1.303g/cm3 |
|---|---|
| Boiling Point | 664.2ºC at 760 mmHg |
| Molecular Formula | C26H40N2O18 |
| Molecular Weight | 668.59800 |
| Flash Point | 355.5ºC |
| Exact Mass | 668.22800 |
| PSA | 235.34000 |
| Index of Refraction | 1.487 |
| InChIKey | GNJXVFXIDHCCKR-UHFFFAOYSA-N |
| SMILES | CC(=O)OCOC(=O)CN(CCOCCOCCN(CC(=O)OCOC(C)=O)CC(=O)OCOC(C)=O)CC(=O)OCOC(C)=O |
| EGTA acetoxymethyl ester |
| Egta-AME |
| EGTA/AM |
| EGTA-AM |