(+)-DOI hydrochloride structure
|
Common Name | (+)-DOI hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 99665-05-1 | Molecular Weight | 357.61600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H17ClINO2 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Name | (+)-DOI hydrochloride |
|---|
| Molecular Formula | C11H17ClINO2 |
|---|---|
| Molecular Weight | 357.61600 |
| Exact Mass | 356.99900 |
| PSA | 44.48000 |
| LogP | 3.70040 |
| InChIKey | QVFDMWGKHUFODK-FJXQXJEOSA-N |
| SMILES | COc1cc(CC(C)N)c(OC)cc1I.Cl |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| HS Code | 2922299090 |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |