methyl 2-[4-(5-propanoylfuran-2-yl)oxyphenyl]propanoate structure
|
Common Name | methyl 2-[4-(5-propanoylfuran-2-yl)oxyphenyl]propanoate | ||
|---|---|---|---|---|
| CAS Number | 99834-92-1 | Molecular Weight | 302.32200 | |
| Density | 1.158g/cm3 | Boiling Point | 414.9ºC at 760 mmHg | |
| Molecular Formula | C17H18O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.7ºC | |
| Name | methyl 2-[4-(5-propanoylfuran-2-yl)oxyphenyl]propanoate |
|---|
| Density | 1.158g/cm3 |
|---|---|
| Boiling Point | 414.9ºC at 760 mmHg |
| Molecular Formula | C17H18O5 |
| Molecular Weight | 302.32200 |
| Flash Point | 204.7ºC |
| Exact Mass | 302.11500 |
| PSA | 65.74000 |
| LogP | 3.94110 |
| Index of Refraction | 1.527 |
| InChIKey | BXQIXWRORDPESF-UHFFFAOYSA-N |
| SMILES | CCC(=O)c1ccc(Oc2ccc(C(C)C(=O)OC)cc2)o1 |
|
~%
methyl 2-[4-(5-... CAS#:99834-92-1 |
| Literature: Sarma; Krishna; Shridhar; Seshagiri; Taneja Indian Journal of Chemistry - Section B Organic Chemistry Including Medicinal Chemistry, 1989 , vol. 28, # 11 p. 993 - 995 |
|
~%
methyl 2-[4-(5-... CAS#:99834-92-1 |
| Literature: Sarma; Krishna; Shridhar; Seshagiri; Taneja Indian Journal of Chemistry - Section B Organic Chemistry Including Medicinal Chemistry, 1989 , vol. 28, # 11 p. 993 - 995 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |