3-(1-phenylethyl)-1,3-oxazolidine-2,4-dione structure
|
Common Name | 3-(1-phenylethyl)-1,3-oxazolidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 99843-21-7 | Molecular Weight | 205.21000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(1-phenylethyl)-1,3-oxazolidine-2,4-dione |
|---|
| Molecular Formula | C11H11NO3 |
|---|---|
| Molecular Weight | 205.21000 |
| Exact Mass | 205.07400 |
| PSA | 46.61000 |
| LogP | 1.66430 |
| InChIKey | OBWCRFQZWIKNJM-UHFFFAOYSA-N |
| SMILES | CC(c1ccccc1)N1C(=O)COC1=O |
|
~%
3-(1-phenylethy... CAS#:99843-21-7 |
| Literature: Shapiro et al. Journal of the American Chemical Society, 1959 , vol. 81, p. 6498,6503 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |