3-methyl-2-oxo-4-phenylbut-3-enoic acid structure
|
Common Name | 3-methyl-2-oxo-4-phenylbut-3-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 99846-09-0 | Molecular Weight | 190.19500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-methyl-2-oxo-4-phenylbut-3-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H10O3 |
|---|---|
| Molecular Weight | 190.19500 |
| Exact Mass | 190.06300 |
| PSA | 54.37000 |
| LogP | 1.74360 |
| InChIKey | SNDMHVXEPGDVLG-UHFFFAOYSA-N |
| SMILES | CC(=Cc1ccccc1)C(=O)C(=O)O |
|
~%
3-methyl-2-oxo-... CAS#:99846-09-0 |
| Literature: Vaughan; Covey Journal of the American Chemical Society, 1958 , vol. 80, p. 2197,2200 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-Butenoic acid,3-methyl-2-oxo-4-phenyl |