Propanamide, 2-bromo-N-(1-cyanocyclohexyl)-N-methyl
Modify Date: 2026-09-07 13:31:38
Propanamide, 2-bromo-N-(1-cyanocyclohexyl)-N-methyl structure
|
Common Name | Propanamide, 2-bromo-N-(1-cyanocyclohexyl)-N-methyl | ||
|---|---|---|---|---|
| CAS Number | 99862-35-8 | Molecular Weight | 273.17 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H17BrN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Propanamide, 2-bromo-N-(1-cyanocyclohexyl)-N-methyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H17BrN2O |
|---|---|
| Molecular Weight | 273.17 |
| InChIKey | CJDYDCLNIJWXBT-UHFFFAOYSA-N |
| SMILES | CC(Br)C(=O)N(C)C1(C#N)CCCCC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Propanamide, 2-bromo-N-(1-cyanocyclohexyl)-N-methyl? |
| A: CAS number of Propanamide, 2-bromo-N-(1-cyanocyclohexyl)-N-methyl is 99862-35-8. |
| Q: What is the Chinese name of 99862-35-8? |
| A: Chinese name of 99862-35-8 is 99862-35-8. |
| Q: What is the SMILES notation of Propanamide, 2-bromo-N-(1-cyanocyclohexyl)-N-methyl? |
| A: SMILES notation of Propanamide, 2-bromo-N-(1-cyanocyclohexyl)-N-methyl is CC(Br)C(=O)N(C)C1(C#N)CCCCC1. |
| Q: What is the English name of Propanamide, 2-bromo-N-(1-cyanocyclohexyl)-N-methyl? |
| A: The English name of Propanamide, 2-bromo-N-(1-cyanocyclohexyl)-N-methyl is Propanamide, 2-bromo-N-(1-cyanocyclohexyl)-N-methyl. |
| Q: What is the molecular weight of Propanamide, 2-bromo-N-(1-cyanocyclohexyl)-N-methyl? |
| A: Molecular weight of Propanamide, 2-bromo-N-(1-cyanocyclohexyl)-N-methyl is 273.17. |
| Q: What is the InChIKey of Propanamide, 2-bromo-N-(1-cyanocyclohexyl)-N-methyl? |
| A: InChIKey of Propanamide, 2-bromo-N-(1-cyanocyclohexyl)-N-methyl is CJDYDCLNIJWXBT-UHFFFAOYSA-N. |
| Q: What is the molecular formula of Propanamide, 2-bromo-N-(1-cyanocyclohexyl)-N-methyl? |
| A: Molecular formula of Propanamide, 2-bromo-N-(1-cyanocyclohexyl)-N-methyl is C11H17BrN2O. |