bis(2-chloroethyl)-hexylazanium,chloride structure
|
Common Name | bis(2-chloroethyl)-hexylazanium,chloride | ||
|---|---|---|---|---|
| CAS Number | 99862-88-1 | Molecular Weight | 262.64700 | |
| Density | N/A | Boiling Point | 224ºC at 760mmHg | |
| Molecular Formula | C10H22Cl3N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 89.3ºC | |
| Name | bis(2-chloroethyl)-hexylazanium,chloride |
|---|
| Boiling Point | 224ºC at 760mmHg |
|---|---|
| Molecular Formula | C10H22Cl3N |
| Molecular Weight | 262.64700 |
| Flash Point | 89.3ºC |
| Exact Mass | 261.08200 |
| PSA | 3.24000 |
| LogP | 4.14830 |
| InChIKey | PEEJGSDACNRYIE-UHFFFAOYSA-N |
| SMILES | CCCCCC[NH+](CCCl)CCCl.[Cl-] |
|
~%
bis(2-chloroeth... CAS#:99862-88-1 |
| Literature: Zuniga, H.; Bartulin, J.; Ramirez, A.; Muller, H.; Taylor, T. R. Molecular Crystals and Liquid Crystals (1969-1991), 1990 , vol. 185, p. 131 - 140 |
|
~%
bis(2-chloroeth... CAS#:99862-88-1 |
| Literature: Zuniga, H.; Bartulin, J.; Ramirez, A.; Muller, H.; Taylor, T. R. Molecular Crystals and Liquid Crystals (1969-1991), 1990 , vol. 185, p. 131 - 140 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |