2-Chloro-5-methylbenzene-1-sulfonyl chloride structure
|
Common Name | 2-Chloro-5-methylbenzene-1-sulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 99876-69-4 | Molecular Weight | 225.09200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H6Cl2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-chloro-5-methylbenzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H6Cl2O2S |
|---|---|
| Molecular Weight | 225.09200 |
| Exact Mass | 223.94700 |
| PSA | 42.52000 |
| LogP | 3.65670 |
| InChIKey | IJUVBGAZPUZWJR-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Cl)c(S(=O)(=O)Cl)c1 |
|
~78%
2-Chloro-5-meth... CAS#:99876-69-4 |
| Literature: Samanta, Soma; Srikanth; Banerjee, Suchandra; Debnath, Bikash; Gayen, Shovanlal; Jha, Tarun Bioorganic and Medicinal Chemistry, 2004 , vol. 12, # 6 p. 1413 - 1423 |
|
~%
2-Chloro-5-meth... CAS#:99876-69-4 |
| Literature: Loynes,J.M. et al. Journal of Medicinal Chemistry, 1965 , vol. 8, p. 691 - 694 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-Chlortoluol-3-sulfonchlorid |
| 4-Chlor-toluol-3-sulfonylchlorid |
| 2-chloro-5-methylbenzene-1-sulfonyl chloride |
| 6-Chlor-3-methyl-benzolsulfonsaeure-chlorid |
| Benzenesulfonyl chloride,2-chloro-5-methyl |
| 4-chloro-toluene-3-sulfonyl chloride |