6-(4-Chlorophenoxy)nicotinonitrile structure
|
Common Name | 6-(4-Chlorophenoxy)nicotinonitrile | ||
|---|---|---|---|---|
| CAS Number | 99902-70-2 | Molecular Weight | 230.65000 | |
| Density | 1.35g/cm3 | Boiling Point | 369.9ºC at 760mmHg | |
| Molecular Formula | C12H7ClN2O | Melting Point | 129-131ºC | |
| MSDS | N/A | Flash Point | 177.5ºC | |
| Name | 6-(4-chlorophenoxy)pyridine-3-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 369.9ºC at 760mmHg |
| Melting Point | 129-131ºC |
| Molecular Formula | C12H7ClN2O |
| Molecular Weight | 230.65000 |
| Flash Point | 177.5ºC |
| Exact Mass | 230.02500 |
| PSA | 45.91000 |
| LogP | 3.39898 |
| Index of Refraction | 1.626 |
| InChIKey | DAHIOIPBXNVSIW-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc(Oc2ccc(Cl)cc2)nc1 |
| HS Code | 2933399090 |
|---|
|
~%
6-(4-Chlorophen... CAS#:99902-70-2 |
| Literature: Markley; Tong; Dulworth; Steward; Goralski; Johnston; Wood; Vinogradoff; Bargar Journal of Medicinal Chemistry, 1986 , vol. 29, # 3 p. 427 - 433 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| hms566g08 |