6-(4-methylphenoxy)pyridine-3-carbonitrile
6-(4-methylphenoxy)pyridine-3-carbonitrile structure
|
Common Name | 6-(4-methylphenoxy)pyridine-3-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 99902-75-7 | Molecular Weight | 210.23100 | |
| Density | 1.19g/cm3 | Boiling Point | 352.6ºC at 760 mmHg | |
| Molecular Formula | C13H10N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-(4-methylphenoxy)pyridine-3-carbonitrile |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 352.6ºC at 760 mmHg |
| Molecular Formula | C13H10N2O |
| Molecular Weight | 210.23100 |
| Flash Point | 167ºC |
| Exact Mass | 210.07900 |
| PSA | 45.91000 |
| LogP | 3.05398 |
| Index of Refraction | 1.602 |
| InChIKey | IZHLMEHEGRNQMP-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Oc2ccc(C#N)cn2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
6-(4-methylphen... CAS#:99902-75-7 |
| Literature: Markley; Tong; Dulworth; Steward; Goralski; Johnston; Wood; Vinogradoff; Bargar Journal of Medicinal Chemistry, 1986 , vol. 29, # 3 p. 427 - 433 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 6-(4-methylphenoxy)pyridine-3-carbonitrile? |
| A: Polar surface area (PSA) of 6-(4-methylphenoxy)pyridine-3-carbonitrile is 45.91000. |
| Q: What is the LogP of 6-(4-methylphenoxy)pyridine-3-carbonitrile? |
| A: LogP of 6-(4-methylphenoxy)pyridine-3-carbonitrile is 3.05398. |
| Q: What is the molecular weight of 6-(4-methylphenoxy)pyridine-3-carbonitrile? |
| A: Molecular weight of 6-(4-methylphenoxy)pyridine-3-carbonitrile is 210.23100. |
| Q: What is the English name of 6-(4-methylphenoxy)pyridine-3-carbonitrile? |
| A: The English name of 6-(4-methylphenoxy)pyridine-3-carbonitrile is 6-(4-methylphenoxy)pyridine-3-carbonitrile. |
| Q: What is the InChIKey of 6-(4-methylphenoxy)pyridine-3-carbonitrile? |
| A: InChIKey of 6-(4-methylphenoxy)pyridine-3-carbonitrile is IZHLMEHEGRNQMP-UHFFFAOYSA-N. |
| Q: What is the CAS number of 6-(4-methylphenoxy)pyridine-3-carbonitrile? |
| A: CAS number of 6-(4-methylphenoxy)pyridine-3-carbonitrile is 99902-75-7. |
| Q: What is the molecular formula of 6-(4-methylphenoxy)pyridine-3-carbonitrile? |
| A: Molecular formula of 6-(4-methylphenoxy)pyridine-3-carbonitrile is C13H10N2O. |
| Q: What is the boiling point of 6-(4-methylphenoxy)pyridine-3-carbonitrile? |
| A: Boiling point of 6-(4-methylphenoxy)pyridine-3-carbonitrile is 352.6ºC at 760 mmHg. |
| Q: What is the Chinese name of 99902-75-7? |
| A: Chinese name of 99902-75-7 is 99902-75-7. |
| Q: What are the upstream materials of 6-(4-methylphenoxy)pyridine-3-carbonitrile? |
| A: Related upstream materials(CAS) of 6-(4-methylphenoxy)pyridine-3-carbonitrile: 33252-28-7;106-44-5. |