6-(4-methylphenoxy)pyridine-3-carbonitrile structure
|
Common Name | 6-(4-methylphenoxy)pyridine-3-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 99902-75-7 | Molecular Weight | 210.23100 | |
| Density | 1.19g/cm3 | Boiling Point | 352.6ºC at 760 mmHg | |
| Molecular Formula | C13H10N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167ºC | |
| Name | 6-(4-methylphenoxy)pyridine-3-carbonitrile |
|---|
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 352.6ºC at 760 mmHg |
| Molecular Formula | C13H10N2O |
| Molecular Weight | 210.23100 |
| Flash Point | 167ºC |
| Exact Mass | 210.07900 |
| PSA | 45.91000 |
| LogP | 3.05398 |
| Index of Refraction | 1.602 |
| InChIKey | IZHLMEHEGRNQMP-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Oc2ccc(C#N)cn2)cc1 |
|
~%
6-(4-methylphen... CAS#:99902-75-7 |
| Literature: Markley; Tong; Dulworth; Steward; Goralski; Johnston; Wood; Vinogradoff; Bargar Journal of Medicinal Chemistry, 1986 , vol. 29, # 3 p. 427 - 433 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |