5-chloro-2-(3,4-dichlorophenoxy)benzonitrile
Modify Date: 2025-11-30 16:06:06
5-chloro-2-(3,4-dichlorophenoxy)benzonitrile structure
|
Common Name | 5-chloro-2-(3,4-dichlorophenoxy)benzonitrile | ||
|---|---|---|---|---|
| CAS Number | 99902-89-3 | Molecular Weight | 298.55200 | |
| Density | 1.49g/cm3 | Boiling Point | 386.5ºC at 760 mmHg | |
| Molecular Formula | C13H6Cl3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.6ºC | |
| Name | 5-chloro-2-(3,4-dichlorophenoxy)benzonitrile |
|---|
| Density | 1.49g/cm3 |
|---|---|
| Boiling Point | 386.5ºC at 760 mmHg |
| Molecular Formula | C13H6Cl3NO |
| Molecular Weight | 298.55200 |
| Flash Point | 187.6ºC |
| Exact Mass | 296.95100 |
| PSA | 33.02000 |
| LogP | 5.31078 |
| Index of Refraction | 1.643 |
| InChIKey | XIJAMFINYREQMF-UHFFFAOYSA-N |
| SMILES | N#Cc1cc(Cl)ccc1Oc1ccc(Cl)c(Cl)c1 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: Lowest concentration to reduce viral effect by 50% or more against Rhinovirus (RV)-2
Source: ChEMBL
Target: Enterovirus
External Id: CHEMBL799620
|
|
Name: Lowest concentration to reduce viral effect by 50% or more against Rhinovirus (RV)-1A
Source: ChEMBL
Target: Enterovirus
External Id: CHEMBL800917
|
|
Name: Ratio of the MIC50 of 6-(4-Nitro-phenoxy)-nicotinonitrile compared to compound obtain...
Source: ChEMBL
Target: Coxsackievirus
External Id: CHEMBL661536
|
|
Name: Cytotoxicity concentration in HeLa cells
Source: ChEMBL
Target: HeLa
External Id: CHEMBL641837
|
|
Name: Lowest concentration to reduce viral effect by 50% or more against coxsackie virus A2...
Source: ChEMBL
Target: Coxsackievirus
External Id: CHEMBL665061
|
Total 5, Current Page 1 of 1
1