1-chloro-3-(4-methylsulfonylphenoxy)benzene
Modify Date: 2026-07-04 18:46:15
1-chloro-3-(4-methylsulfonylphenoxy)benzene structure
|
Common Name | 1-chloro-3-(4-methylsulfonylphenoxy)benzene | ||
|---|---|---|---|---|
| CAS Number | 99902-91-7 | Molecular Weight | 282.74300 | |
| Density | 1.322g/cm3 | Boiling Point | 434.6ºC at 760 mmHg | |
| Molecular Formula | C13H11ClO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.7ºC | |
| Name | 1-chloro-3-(4-methylsulfonylphenoxy)benzene |
|---|
| Density | 1.322g/cm3 |
|---|---|
| Boiling Point | 434.6ºC at 760 mmHg |
| Molecular Formula | C13H11ClO3S |
| Molecular Weight | 282.74300 |
| Flash Point | 216.7ºC |
| Exact Mass | 282.01200 |
| PSA | 51.75000 |
| LogP | 4.61660 |
| Index of Refraction | 1.583 |
| InChIKey | DLMKHJPFUNIGAJ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1ccc(Oc2cccc(Cl)c2)cc1 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: Lowest concentration to reduce viral effect by 50% or more against Rhinovirus (RV)-2
Source: ChEMBL
Target: Enterovirus
External Id: CHEMBL799620
|
|
Name: Ratio of the MIC50 of 6-(4-Nitro-phenoxy)-nicotinonitrile compared to compound obtain...
Source: ChEMBL
Target: Coxsackievirus
External Id: CHEMBL661536
|
|
Name: Cytotoxicity concentration in HeLa cells
Source: ChEMBL
Target: HeLa
External Id: CHEMBL641837
|
|
Name: Lowest concentration to reduce viral effect by 50% or more against coxsackie virus A2...
Source: ChEMBL
Target: Coxsackievirus
External Id: CHEMBL665061
|
|
Name: Ratio of the MIC50 of 6-(4-Nitro-phenoxy)-nicotinonitrile compared to compound obtain...
Source: ChEMBL
Target: Enterovirus
External Id: CHEMBL799621
|
Total 5, Current Page 1 of 1
1