2-(3,4-dichlorophenoxy)pyridine-4-carbonitrile
2-(3,4-dichlorophenoxy)pyridine-4-carbonitrile structure
|
Common Name | 2-(3,4-dichlorophenoxy)pyridine-4-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 99902-94-0 | Molecular Weight | 265.09500 | |
| Density | 1.46g/cm3 | Boiling Point | 380.6ºC at 760 mmHg | |
| Molecular Formula | C12H6Cl2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(3,4-dichlorophenoxy)pyridine-4-carbonitrile |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 380.6ºC at 760 mmHg |
| Molecular Formula | C12H6Cl2N2O |
| Molecular Weight | 265.09500 |
| Flash Point | 184ºC |
| Exact Mass | 263.98600 |
| PSA | 45.91000 |
| LogP | 4.05238 |
| Index of Refraction | 1.637 |
| InChIKey | IFKUMJHUUPRDGR-UHFFFAOYSA-N |
| SMILES | N#Cc1ccnc(Oc2ccc(Cl)c(Cl)c2)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2-(3,4-dichloro... CAS#:99902-94-0 |
| Literature: Markley; Tong; Dulworth; Steward; Goralski; Johnston; Wood; Vinogradoff; Bargar Journal of Medicinal Chemistry, 1986 , vol. 29, # 3 p. 427 - 433 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of 2-(3,4-dichlorophenoxy)pyridine-4-carbonitrile? |
| A: Boiling point of 2-(3,4-dichlorophenoxy)pyridine-4-carbonitrile is 380.6ºC at 760 mmHg. |
| Q: What is the InChIKey of 2-(3,4-dichlorophenoxy)pyridine-4-carbonitrile? |
| A: InChIKey of 2-(3,4-dichlorophenoxy)pyridine-4-carbonitrile is IFKUMJHUUPRDGR-UHFFFAOYSA-N. |
| Q: What are the upstream materials of 2-(3,4-dichlorophenoxy)pyridine-4-carbonitrile? |
| A: Related upstream materials(CAS) of 2-(3,4-dichlorophenoxy)pyridine-4-carbonitrile: 33252-30-1;95-77-2. |
| Q: What is the polar surface area (PSA) of 2-(3,4-dichlorophenoxy)pyridine-4-carbonitrile? |
| A: Polar surface area (PSA) of 2-(3,4-dichlorophenoxy)pyridine-4-carbonitrile is 45.91000. |
| Q: What is the LogP of 2-(3,4-dichlorophenoxy)pyridine-4-carbonitrile? |
| A: LogP of 2-(3,4-dichlorophenoxy)pyridine-4-carbonitrile is 4.05238. |
| Q: What is the molecular formula of 2-(3,4-dichlorophenoxy)pyridine-4-carbonitrile? |
| A: Molecular formula of 2-(3,4-dichlorophenoxy)pyridine-4-carbonitrile is C12H6Cl2N2O. |
| Q: What is the SMILES notation of 2-(3,4-dichlorophenoxy)pyridine-4-carbonitrile? |
| A: SMILES notation of 2-(3,4-dichlorophenoxy)pyridine-4-carbonitrile is N#Cc1ccnc(Oc2ccc(Cl)c(Cl)c2)c1. |
| Q: What is the molecular weight of 2-(3,4-dichlorophenoxy)pyridine-4-carbonitrile? |
| A: Molecular weight of 2-(3,4-dichlorophenoxy)pyridine-4-carbonitrile is 265.09500. |
| Q: What is the CAS number of 2-(3,4-dichlorophenoxy)pyridine-4-carbonitrile? |
| A: CAS number of 2-(3,4-dichlorophenoxy)pyridine-4-carbonitrile is 99902-94-0. |
| Q: What is the Chinese name of 99902-94-0? |
| A: Chinese name of 99902-94-0 is 99902-94-0. |