N-methyl-N'-(4-methylphenyl)-N-phenylethanimidamide structure
|
Common Name | N-methyl-N'-(4-methylphenyl)-N-phenylethanimidamide | ||
|---|---|---|---|---|
| CAS Number | 99942-70-8 | Molecular Weight | 238.32800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H18N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-methyl-N'-(4-methylphenyl)-N-phenylethanimidamide |
|---|
| Molecular Formula | C16H18N2 |
|---|---|
| Molecular Weight | 238.32800 |
| Exact Mass | 238.14700 |
| PSA | 15.60000 |
| LogP | 4.18130 |
| InChIKey | WQSBOARAGZECDH-UHFFFAOYSA-N |
| SMILES | CC(=Nc1ccc(C)cc1)N(C)c1ccccc1 |
|
~%
N-methyl-N'-(4-... CAS#:99942-70-8 |
| Literature: Raczynska, Ewa; Oszczapowicz, Janusz; Walczak, Malgorzata Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1985 , p. 1087 - 1090 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |