6-chloro-8-methyl-2-methylsulfanyl-7H-purine structure
|
Common Name | 6-chloro-8-methyl-2-methylsulfanyl-7H-purine | ||
|---|---|---|---|---|
| CAS Number | 99980-49-1 | Molecular Weight | 214.67500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H7ClN4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-chloro-8-methyl-2-methylsulfanyl-7H-purine |
|---|
| Molecular Formula | C7H7ClN4S |
|---|---|
| Molecular Weight | 214.67500 |
| Exact Mass | 214.00800 |
| PSA | 79.76000 |
| LogP | 2.03660 |
| InChIKey | RKEBFIJQZVMGKG-UHFFFAOYSA-N |
| SMILES | CSc1nc(Cl)c2[nH]c(C)nc2n1 |
|
~%
6-chloro-8-meth... CAS#:99980-49-1 |
| Literature: Koppel; Robins Journal of Organic Chemistry, 1958 , vol. 23, p. 1457,1458 |
|
~%
6-chloro-8-meth... CAS#:99980-49-1 |
| Literature: Koppel; Robins Journal of Organic Chemistry, 1958 , vol. 23, p. 1457,1458 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |