2-benzylsulfanyl-6-chloropyrimidin-4-amine structure
|
Common Name | 2-benzylsulfanyl-6-chloropyrimidin-4-amine | ||
|---|---|---|---|---|
| CAS Number | 99983-92-3 | Molecular Weight | 251.73500 | |
| Density | 1.39g/cm3 | Boiling Point | 442.6ºC at 760 mmHg | |
| Molecular Formula | C11H10ClN3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.5ºC | |
| Name | 2-benzylsulfanyl-6-chloropyrimidin-4-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 442.6ºC at 760 mmHg |
| Molecular Formula | C11H10ClN3S |
| Molecular Weight | 251.73500 |
| Flash Point | 221.5ºC |
| Exact Mass | 251.02800 |
| PSA | 77.83000 |
| LogP | 2.93460 |
| Index of Refraction | 1.676 |
| InChIKey | LGTXUPUULSWTNA-UHFFFAOYSA-N |
| SMILES | Nc1cc(Cl)nc(SCc2ccccc2)n1 |
|
~%
2-benzylsulfany... CAS#:99983-92-3 |
| Literature: PHARMACIA and UPJOHN COMPANY Patent: EP1247804 A1, 2002 ; Location in patent: Page 11 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| U-31,355 |
| 2-benzylmercapto-4-amino-6-chloropyrimidine |
| 2-benzylmercapto-6-chloro-pyrimidin-4-ylamine |
| 2-Benzylmercapto-6-chlor-pyrimidin-4-ylamin |