4-Amino-2-methylquinoline-6-carboxylic acid structure
|
Common Name | 4-Amino-2-methylquinoline-6-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 99984-73-3 | Molecular Weight | 202.20900 | |
| Density | 1.367 | Boiling Point | 432.4ºC at 760 mmHg | |
| Molecular Formula | C11H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-Amino-2-methylquinoline-6-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.367 |
|---|---|
| Boiling Point | 432.4ºC at 760 mmHg |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.20900 |
| Exact Mass | 202.07400 |
| PSA | 76.21000 |
| LogP | 2.40480 |
| Index of Refraction | 1.716 |
| InChIKey | MRGARODDQXEDJP-UHFFFAOYSA-N |
| SMILES | Cc1cc(N)c2cc(C(=O)O)ccc2n1 |
| HS Code | 2933499090 |
|---|
|
~%
4-Amino-2-methy... CAS#:99984-73-3 |
| Literature: DE831100 , ; DRP/DRBP Org.Chem. |
|
~%
4-Amino-2-methy... CAS#:99984-73-3 |
| Literature: DE831100 , ; DRP/DRBP Org.Chem. |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-amino-2-methyl-quinoline-6-carboxylic acid |
| 4-amino-2-methyl-6-quinolincarboxylic acid |
| 4-amino-2-methyl-6-quinolinecarboxylic acid |
| 4-Amino-2-methyl-chinolin-6-carbonsaeure |