4-[(tert-Butylamino)sulfonyl]benzoic Acid
Modify Date: 2025-09-14 07:41:05
![4-[(tert-Butylamino)sulfonyl]benzoic Acid Structure](https://image.chemsrc.com/caspic/281/99987-05-0.png)
4-[(tert-Butylamino)sulfonyl]benzoic Acid structure
|
Common Name | 4-[(tert-Butylamino)sulfonyl]benzoic Acid | ||
|---|---|---|---|---|
| CAS Number | 99987-05-0 | Molecular Weight | 257.30600 | |
| Density | 1.273g/cm3 | Boiling Point | 415.4ºC at 760 mmHg | |
| Molecular Formula | C11H15NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205ºC | |
| Name | 4-(tert-butylsulfamoyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.273g/cm3 |
|---|---|
| Boiling Point | 415.4ºC at 760 mmHg |
| Molecular Formula | C11H15NO4S |
| Molecular Weight | 257.30600 |
| Flash Point | 205ºC |
| Exact Mass | 257.07200 |
| PSA | 91.85000 |
| LogP | 2.93330 |
| Index of Refraction | 1.546 |
| InChIKey | KLTFWNOBVBGGCG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccc(C(=O)O)cc1 |
| HS Code | 2935009090 |
|---|
|
~%
4-[(tert-Butyla... CAS#:99987-05-0 |
| Literature: Briscoe et al. Journal of the Chemical Society, 1956 , p. 1755,1762 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| 4-tert-Butylsulfamoyl-benzoesaeure |
| 4-tert-Butylsulfamoyl-benzoic acid |