Atorvastatin calcium
Atorvastatin calcium structure
|
Common Name | Atorvastatin calcium | ||
|---|---|---|---|---|
| CAS Number | 134523-03-8 | Molecular Weight | 1155.342 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C66H68CaF2N4O10 | Melting Point | 176-178°C | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Atorvastatin calcium |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Melting Point | 176-178°C |
|---|---|
| Molecular Formula | C66H68CaF2N4O10 |
| Molecular Weight | 1155.342 |
| Exact Mass | 1154.453003 |
| InChIKey | BWFCZHDTTAYGNN-CNZCJKERSA-N |
| SMILES | CC(C)c1c(C(=O)Nc2ccccc2)c(-c2ccccc2)c(-c2ccc(F)cc2)n1CCC(O)CC(O)CC(=O)O.[Ca] |
| Storage condition | Store at +4°C |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xn,T,F |
|---|---|
| Risk Phrases | 20/21/22-36/37/38-39/23/24/25-23/24/25-11 |
| Safety Phrases | 26-36-45-36/37-16-7 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Lipitor |
| Calcium (bR,dR)-2-(p-fluorophenyl)-b,d-dihydroxy-5-isopropyl-3-phenyl-4-(phenylcarbamoyl)pyrrole-1-heptanoate |
| calcium bis{(3R,5R)-7-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-(propan-2-yl)-1H-pyrrol-1-yl]-3,5-dihydroxyheptanoate} |
| [R-(R*, R*)]-7-[2-(4-Fluorophenyl)-5-(1-methylethyl)-3-phenyl-4-(phenylaminocarbonyl)-1H-pyrrol-1-yl]-3,5-dihydroxy-heptanoic acid calcium salt |
| EINECS 200-659-6 |
| calcium bis{(3R,5R)-7-[2-(4-fluorophenyl)-5-(1-methylethyl)-3-phenyl-4-(phenylcarbamoyl)-1H-pyrrol-1-yl]-3,5-dihydroxyheptanoate} |
| Liprimar |
| Lipibec |
| Atorvastatin Calcium |
| Atorvastatin hemicalcium salt |
| 1H-Pyrrole-1-heptanoic acid, 2-(4-fluorophenyl)-β,δ-dihydroxy-5-(1-methylethyl)-3-phenyl-4-[(phenylamino)carbonyl]-, calcium salt, (βR,δR)- (2:1) |
| Calcium bis{(3R,5R)-7-[2-(4-fluorophenyl)-5-isopropyl-3-phenyl-4-(phenylcarbamoyl)-1H-pyrrol-1-yl]-3,5-dihydroxyheptanoate} |
| MFCD03613598 |
| (3R ,5R )-7-[2-(4-Fluorophenyl)-5-Isopropyl-3-Phenyl-4-(Pheynylcarbamoyl)Pyrrol-1-yl]-3,5-Dihydroheptanoic Acid,calcium salt (2:1) Trihydrate |
| Atorvastatin (hemicalcium salt) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Atorvastatin calcium? |
| A: Molecular weight of Atorvastatin calcium is 1155.342. |
| Q: What is the CAS number of Atorvastatin calcium? |
| A: CAS number of Atorvastatin calcium is 134523-03-8. |
| Q: What is the InChIKey of Atorvastatin calcium? |
| A: InChIKey of Atorvastatin calcium is BWFCZHDTTAYGNN-CNZCJKERSA-N. |
| Q: What is the melting point of Atorvastatin calcium? |
| A: Melting point of Atorvastatin calcium is 176-178°C. |
| Q: What is the SMILES notation of Atorvastatin calcium? |
| A: SMILES notation of Atorvastatin calcium is CC(C)c1c(C(=O)Nc2ccccc2)c(-c2ccccc2)c(-c2ccc(F)cc2)n1CCC(O)CC(O)CC(=O)O.[Ca]. |
| Q: What is the safety information for Atorvastatin calcium? |
| A: Safety information for Atorvastatin calcium: 26-36-45-36/37-16-7. |
| Q: What is the English name of Atorvastatin calcium? |
| A: The English name of Atorvastatin calcium is Atorvastatin calcium. |
| Q: What is the molecular formula of Atorvastatin calcium? |
| A: Molecular formula of Atorvastatin calcium is C66H68CaF2N4O10. |
| Q: What are the storage conditions for Atorvastatin calcium? |
| A: Storage conditions for Atorvastatin calcium: Store at +4°C. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |
| Henan Tianfu Chemical Co., Ltd. |