Cimifugin
Modify Date: 2025-08-20 18:28:09
Cimifugin structure
|
Common Name | Cimifugin | ||
|---|---|---|---|---|
| CAS Number | 37921-38-3 | Molecular Weight | 306.310 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 546.4±50.0 °C at 760 mmHg | |
| Molecular Formula | C16H18O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.9±23.6 °C | |
Use of CimifuginCimifugin is a major components of Yu-ping-feng-san, a Chinese medical formula that is used clinically for allergic diseases and characterized by reducing allergy relapse. |
| Name | (2S)-7-(hydroxymethyl)-2-(2-hydroxypropan-2-yl)-4-methoxy-2,3-dihydrofuro[3,2-g]chromen-5-one |
|---|---|
| Synonym | More Synonyms |
| Description | Cimifugin is a major components of Yu-ping-feng-san, a Chinese medical formula that is used clinically for allergic diseases and characterized by reducing allergy relapse. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 546.4±50.0 °C at 760 mmHg |
| Molecular Formula | C16H18O6 |
| Molecular Weight | 306.310 |
| Flash Point | 204.9±23.6 °C |
| Exact Mass | 306.110352 |
| PSA | 89.13000 |
| LogP | 1.21 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.599 |
| InChIKey | ATDBDSBKYKMRGZ-ZDUSSCGKSA-N |
| SMILES | COc1c2c(cc3oc(CO)cc(=O)c13)OC(C(C)(C)O)C2 |
| Storage condition | -20°C |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
CAS#:80681-45-4![(2R,3R,4S,5R,6R)-2-(acetoxymethyl)-6-(((S)-2-(2-acetoxypropan-2-yl)-4-methoxy-5-oxo-2,3-dihydro-5H-furo[3,2-g]chromen-7-yl)methoxy)tetrahydro-2H-pyran-3,4,5-triyl triacetate Structure](https://image.chemsrc.com/caspic/246/80681-47-6.png)
CAS#:80681-47-6| (2R)-7-(Hydroxymethyl)-2-(2-hydroxy-2-propanyl)-4-methoxy-2,3-dihydro-5H-furo[3,2-g]chromen-5-one |
| (2S)-7-(Hydroxymethyl)-2-(2-hydroxypropan-2-yl)-4-methoxy-2,3-dihydro-5H-furo[3,2-g]chromen-5-one |
| Cimifugin |
| I07-0216 |
| (2S)-7-(Hydroxymethyl)-2-(2-hydroxy-2-propanyl)-4-methoxy-2,3-dihydro-5H-furo[3,2-g]chromen-5-one |
| N1342 |