Sodium Silicofluoride structure
|
Common Name | Sodium Silicofluoride | ||
|---|---|---|---|---|
| CAS Number | 16893-85-9 | Molecular Weight | 188.05500 | |
| Density | 2.68 g/mL at 25 °C(lit.) | Boiling Point | N/A | |
| Molecular Formula | F6Na2Si | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | sodium hexafluorosilicate |
|---|---|
| Synonym | More Synonyms |
| Density | 2.68 g/mL at 25 °C(lit.) |
|---|---|
| Molecular Formula | F6Na2Si |
| Molecular Weight | 188.05500 |
| Exact Mass | 187.94700 |
| LogP | 2.14040 |
| Index of Refraction | 1.310 |
| InChIKey | TWGUZEUZLCYTCG-UHFFFAOYSA-N |
| SMILES | F[Si-2](F)(F)(F)(F)F.[Na+].[Na+] |
| Stability | Stable. Incompatible with oxidizing agents, water. Moisture sensitive. |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301 + H311 + H331 |
| Precautionary Statements | P261-P280-P301 + P310-P311 |
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T:Toxic |
| Risk Phrases | R23/24/25 |
| Safety Phrases | S26-S45 |
| RIDADR | UN 2674 6.1/PG 3 |
| WGK Germany | 2 |
| RTECS | VV8410000 |
| Packaging Group | III |
| Hazard Class | 6.1 |
|
Preclinical effectiveness of a novel pulp capping material.
J. Endod. 36(7) , 1222-5, (2010) The purpose of this study was to evaluate the direct pulp capping response to a novel resin-based calcium phosphate cement (RCPC).The RCPC was placed in contact with the exposed healthy pulps of dog t... |
|
|
Hydrogen-bonded frameworks of bis(2-carboxypyridinium) hexafluorosilicate and bis(2-carboxyquinolinium) hexafluorosilicate dihydrate.
Acta Crystallogr. C 63(Pt 9) , o530-4, (2007) In bis(2-carboxypyridinium) hexafluorosilicate, 2C(6)H(6)NO(2)+.SiF6(2-), (I), and bis(2-carboxyquinolinium) hexafluorosilicate dihydrate, 2C(10)H(8)NO(2)+.SiF6(2-).2H2O, (II), the Si atoms of the ani... |
|
|
Influence of pH and oxygen-inhibited layer on fluoride release properties of fluoride sealant.
J. Dent. 35(4) , 275-81, (2007) This study tested the hypothesis that the oxygen-inhibited layer on a light-cured methacrylate based resin and the pH of the storage medium would increase significantly the initial fluoride release an... |
| Sodium hexafluorosilicate |
| EINECS 240-934-8 |
| MFCD00003491 |
| sodium silicofluoride |
| Silicate(2-), hexafluoro-, sodium (1:2) |
| Sodium fluorosilicate |