Triphenyl(vinyl)silane structure
|
Common Name | Triphenyl(vinyl)silane | ||
|---|---|---|---|---|
| CAS Number | 18666-68-7 | Molecular Weight | 286.442 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 365.9±15.0 °C at 760 mmHg | |
| Molecular Formula | C20H18Si | Melting Point | 68-70 °C(lit.) | |
| MSDS | N/A | Flash Point | 161.3±14.0 °C | |
| Name | triphenylvinylsilane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 365.9±15.0 °C at 760 mmHg |
| Melting Point | 68-70 °C(lit.) |
| Molecular Formula | C20H18Si |
| Molecular Weight | 286.442 |
| Flash Point | 161.3±14.0 °C |
| Exact Mass | 286.117767 |
| LogP | 7.02 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.602 |
| InChIKey | OVOIHGSHJGMSMZ-UHFFFAOYSA-N |
| SMILES | C=C[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| WGK Germany | 3 |
| HS Code | 2931900090 |
| Precursor 10 | |
|---|---|
| DownStream 9 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| VINYLTRIPHENYLSILANE |
| EINECS 242-487-4 |
| Triphenylvinylsilane |
| MFCD00051542 |
| ethenyltriphenyl-silan |
| Triphenylvinylsilan |
| Triphenyl(vinyl)silane |
| Silane,ethenyltriphenyl |