Vinyltris(2-methoxyethoxy)silane structure
|
Common Name | Vinyltris(2-methoxyethoxy)silane | ||
|---|---|---|---|---|
| CAS Number | 1067-53-4 | Molecular Weight | 280.390 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 289.5±35.0 °C at 760 mmHg | |
| Molecular Formula | C11H24O6Si | Melting Point | -30 °C | |
| MSDS | Chinese USA | Flash Point | 104.8±26.3 °C | |
| Symbol |
GHS08 |
Signal Word | Warning | |
| Name | Vinyl tris(2-methoxyethoxy) silane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 289.5±35.0 °C at 760 mmHg |
| Melting Point | -30 °C |
| Molecular Formula | C11H24O6Si |
| Molecular Weight | 280.390 |
| Flash Point | 104.8±26.3 °C |
| Exact Mass | 280.134216 |
| PSA | 55.38000 |
| LogP | 3.15 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.429 |
| InChIKey | WOXXJEVNDJOOLV-UHFFFAOYSA-N |
| SMILES | C=C[Si](OCCOC)(OCCOC)OCCOC |
| Storage condition | -196°C |
| Water Solubility | REACTS |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS08 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H361 |
| Precautionary Statements | P281 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | T:Toxic; |
| Risk Phrases | R20/21/22;R36;R61 |
| Safety Phrases | S26-S36/37-S53-S45-S36/37/39 |
| RIDADR | UN 1993 |
| WGK Germany | 1 |
| RTECS | VV6826000 |
| Packaging Group | III |
| Hazard Class | 3.2 |
| HS Code | 2931900090 |
|
~46%
Vinyltris(2-met... CAS#:1067-53-4 |
| Literature: Nagel, R.; Post, H. W. Journal of Organic Chemistry, 1952 , vol. 17, p. 1382 - 1385 Full Text View citing articles Show Details Gmelin Handbook: Si: MVol.C, 79, page 219 - 221 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| CV-5000 |
| Vinyltris(β-methoxyethoxy)silane |
| z6030 |
| 6-ethenyl-6-(2-methoxyethoxy)-2,5,7,10-tetraoxa-6-silaundecane |
| q174 |
| prosil248 |
| GF 58 |
| Vinyl-tris(β-methoxyethoxy)silane |
| A 172 |
| 6-(2-Methoxyethoxy)-6-vinyl-2,5,7,10-tetraoxa-6-silaundecane |
| Vinyltris(2-methoxyethoxy)silane |
| Tris(2-methoxyethoxy)vinylsilane |
| NUCA 172 |
| sh6030 |
| EINECS 213-934-0 |
| MFCD00008500 |