4'-[(2-Butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]-[1,1'-Biphenyl]-2-carbonitrile structure
|
Common Name | 4'-[(2-Butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]-[1,1'-Biphenyl]-2-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 138401-24-8 | Molecular Weight | 385.501 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 576.5±60.0 °C at 760 mmHg | |
| Molecular Formula | C25H27N3O | Melting Point | 95-97°C | |
| MSDS | N/A | Flash Point | 302.5±32.9 °C | |
| Name | 4'-[(2-Butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]-[1,1'-Biphenyl]-2-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 576.5±60.0 °C at 760 mmHg |
| Melting Point | 95-97°C |
| Molecular Formula | C25H27N3O |
| Molecular Weight | 385.501 |
| Flash Point | 302.5±32.9 °C |
| Exact Mass | 385.215424 |
| PSA | 56.46000 |
| LogP | 4.64 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.621 |
| InChIKey | KWEQEHOPDHARIA-UHFFFAOYSA-N |
| SMILES | CCCCC1=NC2(CCCC2)C(=O)N1Cc1ccc(-c2ccccc2C#N)cc1 |
| Storage condition | Refrigerator |
| Hazard Codes | N:Dangerousfortheenvironment; |
|---|---|
| Risk Phrases | R50/53 |
| Safety Phrases | S60-S61 |
| HS Code | 2933990090 |
| Precursor 8 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: Inhibition of Wistar rat brain AChE by Ellman colorimetric assay
Source: ChEMBL
Target: Acetylcholinesterase
External Id: CHEMBL899127
|
|
Name: Inhibition of human serum AChE by Ellman colorimetric assay
Source: ChEMBL
Target: Acetylcholinesterase
External Id: CHEMBL899128
|
|
Name: Inhibition of electric eel AChE by Ellman colorimetric assay
Source: ChEMBL
Target: Acetylcholinesterase
External Id: CHEMBL899129
|
|
Name: Antagonistic activity through inhibition of A II induced contractions on rabbit aorti...
Source: ChEMBL
Target: Oryctolagus cuniculus
External Id: CHEMBL770909
|
|
Name: Binding affinity for Angiotensin II receptor, type 1 measured by ability to displace ...
Source: ChEMBL
Target: Type-1B angiotensin II receptor
External Id: CHEMBL644582
|
| 4'-[(2-Butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]biphenyl-2-carbonitrile |
| 4'-(2-Butyl-4-oxo-1,3-diaza-spiro[4.4]non-1-en-3-ylmethyl)biphenyl-2-carbonitrile |
| 4'-[(2-Butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]-[1,1'-biphenyl]-2-carbonitrile |
| MFCD06658242 |
| T5NVXNJ A1R DR BCN&& E4 C-& AL5XTJ |
| EINECS 423-500-4 |
| 4'-[(2-Butyl-4-oxo-1,3-diazaspiro[4,4]non-1-en-3-yl)methyl]-[1,1'-biphenyl]-2-carbonitrile |
| 4'-[(2-Butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]biphenyl-2-carbonitril |
| 4'-[(2-Butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]-2-biphenylcarbonitrile |
| 4'-[(2-Butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]-(1,1'-biphenyl)-2-carbonitrile |
| 2-Butyl-3-[[2'-cyano-[1,1'-biphenyl]-4-yl]methyl]-1,3-diazaspiro[4,4]non-1-en-4-one |