BIS(2-ETHYLHEXYL) PHTHALATE-3,4,5,6-D4 structure
|
Common Name | BIS(2-ETHYLHEXYL) PHTHALATE-3,4,5,6-D4 | ||
|---|---|---|---|---|
| CAS Number | 93951-87-2 | Molecular Weight | 394.58100 | |
| Density | 0.996 g/mL at 25ºC | Boiling Point | 231ºC5 mm Hg(lit.) | |
| Molecular Formula | C24H34D4O4 | Melting Point | -50ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 207.2ºC | |
| Symbol |
GHS08 |
Signal Word | Danger | |
| Name | bis(2-ethylhexyl) 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.996 g/mL at 25ºC |
|---|---|
| Boiling Point | 231ºC5 mm Hg(lit.) |
| Melting Point | -50ºC(lit.) |
| Molecular Formula | C24H34D4O4 |
| Molecular Weight | 394.58100 |
| Flash Point | 207.2ºC |
| Exact Mass | 394.30200 |
| PSA | 52.60000 |
| LogP | 6.43300 |
| Index of Refraction | 1.488 |
| InChIKey | BJQHLKABXJIVAM-SAQXESPHSA-N |
| SMILES | CCCCC(CC)COC(=O)c1ccccc1C(=O)OCC(CC)CCCC |
|
Occurrence and risk assessment of selected phthalates in drinking water from waterworks in China.
Environ. Sci. Pollut. Res. Int. 22 , 10690-8, (2015) The first nationwide survey of six phthalates (diethyl phthalate (DEP); dimethyl phthalate (DMP); di-n-butyl phthalate (DBP); butyl benzyl phthalate (BBP); bis(2-ethylhexyl) phthalate (DEHP); din-octy... |
| Bis(2-ethylhexyl)phthalate-3,4,5,6-d4 |
| Deuterated DEHP |
| Di(isooctyl) Phthalate-d4 |
| Etalon-d4 |
| DEHP-d4 |
| MFCD00143759 |
| Palatinol AH-d4 |
| Bisoflex DOP-d4 |
| Bisoflex 81-d4 |
| Octyl Phthalate-d4 |