Bis-PEG6-acid
Modify Date: 2026-07-15 18:54:34
Bis-PEG6-acid structure
|
Common Name | Bis-PEG6-acid | ||
|---|---|---|---|---|
| CAS Number | 77855-76-6 | Molecular Weight | 354.35 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H26O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Bis-PEG6-acidPEG6-(CH2CO2H)2 is a symmetric PEG PROTAC linker, for the synthesis of Homo-PROTACs which is bivalent small-molecule dimerizers of the VHL E3 ubiquitin ligase to induce self-degradation[1]. |
| Name | PEG6-(CH2CO2H)2 |
|---|
| Description | PEG6-(CH2CO2H)2 is a symmetric PEG PROTAC linker, for the synthesis of Homo-PROTACs which is bivalent small-molecule dimerizers of the VHL E3 ubiquitin ligase to induce self-degradation[1]. |
|---|---|
| Related Catalog | |
| Target |
PROTAC linker[1] |
| References |
| Molecular Formula | C14H26O10 |
|---|---|
| Molecular Weight | 354.35 |
| InChIKey | DCQRSABUSOYSIY-UHFFFAOYSA-N |
| SMILES | O=C(O)COCCOCCOCCOCCOCCOCC(=O)O |
| Hazard Codes | Xi |
|---|