fmoc-(s)-3-amino-3-(3-trifluoromethyl-phenyl)-propionic acid
fmoc-(s)-3-amino-3-(3-trifluoromethyl-phenyl)-propionic acid structure
|
Common Name | fmoc-(s)-3-amino-3-(3-trifluoromethyl-phenyl)-propionic acid | ||
|---|---|---|---|---|
| CAS Number | 507472-20-0 | Molecular Weight | 455.426 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 603.8±55.0 °C at 760 mmHg | |
| Molecular Formula | C25H20F3NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 319.0±31.5 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[3-(trifluoromethyl)phenyl]propanoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 603.8±55.0 °C at 760 mmHg |
| Molecular Formula | C25H20F3NO4 |
| Molecular Weight | 455.426 |
| Flash Point | 319.0±31.5 °C |
| Exact Mass | 455.134430 |
| PSA | 75.63000 |
| LogP | 5.73 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.587 |
| InChIKey | YOGSOMNKKBEWAJ-QFIPXVFZSA-N |
| SMILES | O=C(O)CC(NC(=O)OCC1c2ccccc2-c2ccccc21)c1cccc(C(F)(F)F)c1 |
| Storage condition | 2-8°C |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Fmoc-3-Trifluoromethyl-L-b-phenylalanine |
| (3S)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-3-[3-(trifluoromethyl)phenyl]propanoic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[3-(trifluoromethyl)phenyl]propanoic acid? |
| A: Molecular formula of (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[3-(trifluoromethyl)phenyl]propanoic acid is C25H20F3NO4. |
| Q: What is the English name of (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[3-(trifluoromethyl)phenyl]propanoic acid? |
| A: The English name of (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[3-(trifluoromethyl)phenyl]propanoic acid is (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[3-(trifluoromethyl)phenyl]propanoic acid. |
| Q: What is the SMILES notation of (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[3-(trifluoromethyl)phenyl]propanoic acid? |
| A: SMILES notation of (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[3-(trifluoromethyl)phenyl]propanoic acid is O=C(O)CC(NC(=O)OCC1c2ccccc2-c2ccccc21)c1cccc(C(F)(F)F)c1. |
| Q: What are the storage conditions for (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[3-(trifluoromethyl)phenyl]propanoic acid? |
| A: Storage conditions for (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[3-(trifluoromethyl)phenyl]propanoic acid: 2-8°C. |
| Q: What is the boiling point of (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[3-(trifluoromethyl)phenyl]propanoic acid? |
| A: Boiling point of (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[3-(trifluoromethyl)phenyl]propanoic acid is 603.8±55.0 °C at 760 mmHg. |
| Q: What is the InChIKey of (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[3-(trifluoromethyl)phenyl]propanoic acid? |
| A: InChIKey of (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[3-(trifluoromethyl)phenyl]propanoic acid is YOGSOMNKKBEWAJ-QFIPXVFZSA-N. |
| Q: What is the molecular weight of (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[3-(trifluoromethyl)phenyl]propanoic acid? |
| A: Molecular weight of (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[3-(trifluoromethyl)phenyl]propanoic acid is 455.426. |
| Q: What English synonyms does (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[3-(trifluoromethyl)phenyl]propanoic acid have? |
| A: English synonyms of (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[3-(trifluoromethyl)phenyl]propanoic acid: Fmoc-3-Trifluoromethyl-L-b-phenylalanine, (3S)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-3-[3-(trifluoromethyl)phenyl]propanoic acid. |
| Q: What is the CAS number of (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[3-(trifluoromethyl)phenyl]propanoic acid? |
| A: CAS number of (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[3-(trifluoromethyl)phenyl]propanoic acid is 507472-20-0. |
| Q: What is the LogP of (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[3-(trifluoromethyl)phenyl]propanoic acid? |
| A: LogP of (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[3-(trifluoromethyl)phenyl]propanoic acid is 5.73. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |