(6-Phenyl-3-pyridinyl)boronic acid
(6-Phenyl-3-pyridinyl)boronic acid structure
|
Common Name | (6-Phenyl-3-pyridinyl)boronic acid | ||
|---|---|---|---|---|
| CAS Number | 155079-10-0 | Molecular Weight | 199.014 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 401.1±47.0 °C at 760 mmHg | |
| Molecular Formula | C11H10BNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.4±29.3 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (6-phenylpyridin-3-yl)boronic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 401.1±47.0 °C at 760 mmHg |
| Molecular Formula | C11H10BNO2 |
| Molecular Weight | 199.014 |
| Flash Point | 196.4±29.3 °C |
| Exact Mass | 199.080460 |
| PSA | 53.35000 |
| LogP | 2.00 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.614 |
| InChIKey | XSQUPVXOENTCJV-UHFFFAOYSA-N |
| SMILES | OB(O)c1ccc(-c2ccccc2)nc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
(6-Phenyl-3-pyr... CAS#:155079-10-0 |
| Literature: EP2492276 A1, ; Page/Page column 90-91 ; |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 6-PHENYLPYRIDINE-3-BORONIC ACID |
| 2-Phenyl-5-pyridinyl-5-boronic acid |
| (6-Phenylpyridin-3-yl)boronic acid |
| 6-phenylpyridin-3-yl-3-boronic acid |
| 6-Phenylpyridin-3-ylboronic acid |
| 6-phenylpyridyl-3-boric acid |
| 2-phenylpyridin-5-ylboric acid |
| (6-Phenyl-3-pyridinyl)boronic acid |
| 2-Phenylpyridine-5-boronic acid |
| 6-phenyl-3-pyridinylboronic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does (6-phenylpyridin-3-yl)boronic acid have? |
| A: English synonyms of (6-phenylpyridin-3-yl)boronic acid: 6-PHENYLPYRIDINE-3-BORONIC ACID, 2-Phenyl-5-pyridinyl-5-boronic acid, (6-Phenylpyridin-3-yl)boronic acid, 6-phenylpyridin-3-yl-3-boronic acid, 6-Phenylpyridin-3-ylboronic acid, 6-phenylpyridyl-3-boric acid, 2-phenylpyridin-5-ylboric acid, (6-Phenyl-3-pyridinyl)boronic acid, 2-Phenylpyridine-5-boronic acid, 6-phenyl-3-pyridinylboronic acid. |
| Q: What is the English name of (6-phenylpyridin-3-yl)boronic acid? |
| A: The English name of (6-phenylpyridin-3-yl)boronic acid is (6-phenylpyridin-3-yl)boronic acid. |
| Q: What is the molecular weight of (6-phenylpyridin-3-yl)boronic acid? |
| A: Molecular weight of (6-phenylpyridin-3-yl)boronic acid is 199.014. |
| Q: What is the CAS number of (6-phenylpyridin-3-yl)boronic acid? |
| A: CAS number of (6-phenylpyridin-3-yl)boronic acid is 155079-10-0. |
| Q: What are the upstream materials of (6-phenylpyridin-3-yl)boronic acid? |
| A: Related upstream materials(CAS) of (6-phenylpyridin-3-yl)boronic acid: 5419-55-6;27012-25-5. |
| Q: What is the molecular formula of (6-phenylpyridin-3-yl)boronic acid? |
| A: Molecular formula of (6-phenylpyridin-3-yl)boronic acid is C11H10BNO2. |
| Q: What is the LogP of (6-phenylpyridin-3-yl)boronic acid? |
| A: LogP of (6-phenylpyridin-3-yl)boronic acid is 2.00. |
| Q: What is the polar surface area (PSA) of (6-phenylpyridin-3-yl)boronic acid? |
| A: Polar surface area (PSA) of (6-phenylpyridin-3-yl)boronic acid is 53.35000. |
| Q: What is the InChIKey of (6-phenylpyridin-3-yl)boronic acid? |
| A: InChIKey of (6-phenylpyridin-3-yl)boronic acid is XSQUPVXOENTCJV-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of (6-phenylpyridin-3-yl)boronic acid? |
| A: SMILES notation of (6-phenylpyridin-3-yl)boronic acid is OB(O)c1ccc(-c2ccccc2)nc1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |