1,4-dimethylanthraquinone
1,4-dimethylanthraquinone structure
|
Common Name | 1,4-dimethylanthraquinone | ||
|---|---|---|---|---|
| CAS Number | 1519-36-4 | Molecular Weight | 236.26500 | |
| Density | 1.233g/cm3 | Boiling Point | 421ºC at 760 mmHg | |
| Molecular Formula | C16H12O2 | Melting Point | 133-135ºC | |
| MSDS | N/A | Flash Point | 157.4ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,4-dimethylanthraquinone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.233g/cm3 |
|---|---|
| Boiling Point | 421ºC at 760 mmHg |
| Melting Point | 133-135ºC |
| Molecular Formula | C16H12O2 |
| Molecular Weight | 236.26500 |
| Flash Point | 157.4ºC |
| Exact Mass | 236.08400 |
| PSA | 34.14000 |
| LogP | 3.07880 |
| Vapour Pressure | 2.69E-07mmHg at 25°C |
| Index of Refraction | 1.631 |
| InChIKey | DVFAVJDEPNXAME-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C)c2c1C(=O)c1ccccc1C2=O |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 24/25 |
| HS Code | 2914690090 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2914690090 |
|---|---|
| Summary | 2914690090 other quinones。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,4-dimethylanthra-9,10-quinone |
| DIMETHYLANTHRAQUINONE,1,4 |
| MFCD00019169 |
| 1,4-dimethyl anthraquinone |
| 1,4-dimethyl-10-anthracenedione |
| 9.10-Dioxo-1.4-dimethyl-anthracen-dihydrid-(9.10) |
| 1,4-Dimethyl-9,10-anthracenedione |
| 9.10-Dioxo-1.4-dimethyl-9.10-dihydro-anthracen |
| DIMETHYLANTHRAQUINONE,1,4-(RG) |
| 1,4-DIMETHYL-ANTHRAQUINONE |
| 1,4-Dimethyl-anthrachinon |
| 1,4-Dimethyl-9,10-anthraquinone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the melting point of 1,4-dimethylanthraquinone? |
| A: Melting point of 1,4-dimethylanthraquinone is 133-135ºC. |
| Q: What is the polar surface area (PSA) of 1,4-dimethylanthraquinone? |
| A: Polar surface area (PSA) of 1,4-dimethylanthraquinone is 34.14000. |
| Q: What is the SMILES notation of 1,4-dimethylanthraquinone? |
| A: SMILES notation of 1,4-dimethylanthraquinone is Cc1ccc(C)c2c1C(=O)c1ccccc1C2=O. |
| Q: What is the safety information for 1,4-dimethylanthraquinone? |
| A: Safety information for 1,4-dimethylanthraquinone: 24/25. |
| Q: What is the molecular weight of 1,4-dimethylanthraquinone? |
| A: Molecular weight of 1,4-dimethylanthraquinone is 236.26500. |
| Q: What is the LogP of 1,4-dimethylanthraquinone? |
| A: LogP of 1,4-dimethylanthraquinone is 3.07880. |
| Q: What is the CAS number of 1,4-dimethylanthraquinone? |
| A: CAS number of 1,4-dimethylanthraquinone is 1519-36-4. |
| Q: What is the English name of 1,4-dimethylanthraquinone? |
| A: The English name of 1,4-dimethylanthraquinone is 1,4-dimethylanthraquinone. |
| Q: What is the molecular formula of 1,4-dimethylanthraquinone? |
| A: Molecular formula of 1,4-dimethylanthraquinone is C16H12O2. |
| Q: What English synonyms does 1,4-dimethylanthraquinone have? |
| A: English synonyms of 1,4-dimethylanthraquinone: 1,4-dimethylanthra-9,10-quinone, DIMETHYLANTHRAQUINONE,1,4, MFCD00019169, 1,4-dimethyl anthraquinone, 1,4-dimethyl-10-anthracenedione, 9.10-Dioxo-1.4-dimethyl-anthracen-dihydrid-(9.10), 1,4-Dimethyl-9,10-anthracenedione, 9.10-Dioxo-1.4-dimethyl-9.10-dihydro-anthracen, DIMETHYLANTHRAQUINONE,1,4-(RG), 1,4-DIMETHYL-ANTHRAQUINONE, 1,4-Dimethyl-anthrachinon, 1,4-Dimethyl-9,10-anthraquinone. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |