4-Methyl-2-(1,1,1-trifluoro-2-Methylpropan-2-yl)pyridine
4-Methyl-2-(1,1,1-trifluoro-2-Methylpropan-2-yl)pyridine structure
|
Common Name | 4-Methyl-2-(1,1,1-trifluoro-2-Methylpropan-2-yl)pyridine | ||
|---|---|---|---|---|
| CAS Number | 1378865-93-0 | Molecular Weight | 203.204 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 190.2±40.0 °C at 760 mmHg | |
| Molecular Formula | C10H12F3N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 68.8±27.3 °C | |
Summary: 4-Methyl-2-(1,1,1-trifluoro-2-methylpropan-2-yl)pyridine (CAS number: 1378865-93-0), molecular formula C10H12F3N, molecular weight 203.204. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-methyl-2-(1,1,1-trifluoro-2-methylpropan-2-yl)pyridine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 190.2±40.0 °C at 760 mmHg |
| Molecular Formula | C10H12F3N |
| Molecular Weight | 203.204 |
| Flash Point | 68.8±27.3 °C |
| Exact Mass | 203.092178 |
| PSA | 12.89000 |
| LogP | 2.04 |
| Vapour Pressure | 0.8±0.4 mmHg at 25°C |
| Index of Refraction | 1.440 |
| InChIKey | YDCXKPKYKHZBLU-UHFFFAOYSA-N |
| SMILES | Cc1ccnc(C(C)(C)C(F)(F)F)c1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:1217486-61-7This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-Methyl-2-(1,1,1-trifluoro-2-methyl-2-propanyl)pyridine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 4-methyl-2-(1,1,1-trifluoro-2-methylpropan-2-yl)pyridine? |
| A: CAS number of 4-methyl-2-(1,1,1-trifluoro-2-methylpropan-2-yl)pyridine is 1378865-93-0. |
| Q: What are the downstream products of 4-methyl-2-(1,1,1-trifluoro-2-methylpropan-2-yl)pyridine? |
| A: Related downstream products(CAS) of 4-methyl-2-(1,1,1-trifluoro-2-methylpropan-2-yl)pyridine: 1217486-61-7. |
| Q: What is the InChIKey of 4-methyl-2-(1,1,1-trifluoro-2-methylpropan-2-yl)pyridine? |
| A: InChIKey of 4-methyl-2-(1,1,1-trifluoro-2-methylpropan-2-yl)pyridine is YDCXKPKYKHZBLU-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 4-methyl-2-(1,1,1-trifluoro-2-methylpropan-2-yl)pyridine? |
| A: Molecular weight of 4-methyl-2-(1,1,1-trifluoro-2-methylpropan-2-yl)pyridine is 203.204. |
| Q: What is the molecular formula of 4-methyl-2-(1,1,1-trifluoro-2-methylpropan-2-yl)pyridine? |
| A: Molecular formula of 4-methyl-2-(1,1,1-trifluoro-2-methylpropan-2-yl)pyridine is C10H12F3N. |
| Q: What is the SMILES notation of 4-methyl-2-(1,1,1-trifluoro-2-methylpropan-2-yl)pyridine? |
| A: SMILES notation of 4-methyl-2-(1,1,1-trifluoro-2-methylpropan-2-yl)pyridine is Cc1ccnc(C(C)(C)C(F)(F)F)c1. |
| Q: What English synonyms does 4-methyl-2-(1,1,1-trifluoro-2-methylpropan-2-yl)pyridine have? |
| A: English synonyms of 4-methyl-2-(1,1,1-trifluoro-2-methylpropan-2-yl)pyridine: 4-Methyl-2-(1,1,1-trifluoro-2-methyl-2-propanyl)pyridine. |
| Q: What is the boiling point of 4-methyl-2-(1,1,1-trifluoro-2-methylpropan-2-yl)pyridine? |
| A: Boiling point of 4-methyl-2-(1,1,1-trifluoro-2-methylpropan-2-yl)pyridine is 190.2±40.0 °C at 760 mmHg. |
| Q: What is the LogP of 4-methyl-2-(1,1,1-trifluoro-2-methylpropan-2-yl)pyridine? |
| A: LogP of 4-methyl-2-(1,1,1-trifluoro-2-methylpropan-2-yl)pyridine is 2.04. |
| Q: What is the polar surface area (PSA) of 4-methyl-2-(1,1,1-trifluoro-2-methylpropan-2-yl)pyridine? |
| A: Polar surface area (PSA) of 4-methyl-2-(1,1,1-trifluoro-2-methylpropan-2-yl)pyridine is 12.89000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |