3-(Cyclopropylmethoxy)-4-hydroxybenzoic acid structure
|
Common Name | 3-(Cyclopropylmethoxy)-4-hydroxybenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 1243391-44-7 | Molecular Weight | 208.211 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 403.3±30.0 °C at 760 mmHg | |
| Molecular Formula | C11H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.2±18.1 °C | |
| Name | 3-(Cyclopropylmethoxy)-4-hydroxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 403.3±30.0 °C at 760 mmHg |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.211 |
| Flash Point | 162.2±18.1 °C |
| Exact Mass | 208.073563 |
| PSA | 66.76000 |
| LogP | 2.23 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.615 |
| InChIKey | CPGNRCZMIIWDPZ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(O)c(OCC2CC2)c1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918990090 |
|
~87%
3-(Cyclopropylm... CAS#:1243391-44-7 |
| Literature: Synthesis (Germany), , vol. 44, # 23 art. no. SS-2012-H0689-OP, p. 3598 - 3602 |
|
~%
3-(Cyclopropylm... CAS#:1243391-44-7 |
| Literature: Synthesis (Germany), , vol. 44, # 23 art. no. SS-2012-H0689-OP, p. 3598 - 3602 |
|
~%
3-(Cyclopropylm... CAS#:1243391-44-7 |
| Literature: Synthesis (Germany), , vol. 44, # 23 art. no. SS-2012-H0689-OP, p. 3598 - 3602 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-(Cyclopropylmethoxy)-4-hydroxybenzoic acid |
| Roflumilast Impurity 5 |