4043-96-3
4043-96-3 structure
- Name: Sodium Bis(4-nitrophenyl) Phosphate
- Chemical Name: bis(4-nitrophenyl)phosphoric acid sodium salt
- CAS Number: 4043-96-3
- Molecular Formula: C12H8N2NaO8P
- Molecular Weight: 362.16400
- Create Date: 2018-07-25 09:31:30
- Modify Date: 2025-08-27 01:04:31
| Name | bis(4-nitrophenyl)phosphoric acid sodium salt |
|---|---|
| Synonyms |
Sodium Bis(4-nitrophenyl) Phosphate
MFCD00065378 sodium,bis(4-nitrophenyl) phosphate Bis(p-nitrophenyl) phosphate sodium salt EINECS 223-739-2 Phosphoric Acid Bis(4-nitrophenyl) Ester Sodium Salt |
| Boiling Point | 545.7ºC at 760 mmHg |
|---|---|
| Molecular Formula | C12H8N2NaO8P |
| Molecular Weight | 362.16400 |
| Flash Point | 283.8ºC |
| Exact Mass | 361.99200 |
| PSA | 160.04000 |
| LogP | 4.54580 |
| Vapour Pressure | 9.64E-13mmHg at 25°C |
| Storage condition | −20°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2919900090 |
| Precursor 0 | |
|---|---|
| DownStream 6 | |
| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |