| Name | 4-Fluorobenzeneboronic acid |
|---|---|
| Synonyms |
p-fluorophenylboronic acid
QBQR DF 4-Fluorophenylboronic Acid p-fluorobenzeneboronic acid (4-fluorophenyl)dihydroxyborane (4-Fluorophenyl)boronic acid MFCD00039136 4-Fluorobenzeneboronic acid B-(4-Fluorophenyl)boronic acid |
| Description | 4-Fluorobenzeneboronic acid is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 258.4±42.0 °C at 760 mmHg |
| Melting Point | 262-265 °C(lit.) |
| Molecular Formula | C6H6BFO2 |
| Molecular Weight | 139.92 |
| Flash Point | 110.1±27.9 °C |
| Exact Mass | 140.044495 |
| PSA | 40.46000 |
| LogP | 1.64 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.509 |
| Storage condition | 0-6°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335 |
| Precautionary Statements | P280-P301 + P312 + P330-P305 + P351 + P338-P337 + P313 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2931900090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |