302911-94-0
302911-94-0 structure
- Name: (3R-CIS)-(-)-2 3-DIHYDRO-3-ISOPROPYL-7A&
- Chemical Name: (3R,7aS)-7a-methyl-3-propan-2-yl-2,3-dihydropyrrolo[2,1-b][1,3]oxazol-5-one
- CAS Number: 302911-94-0
- Molecular Formula: C10H15NO2
- Molecular Weight: 181.23200
- Create Date: 2018-10-21 17:03:05
- Modify Date: 2024-01-10 23:29:01
| Name | (3R,7aS)-7a-methyl-3-propan-2-yl-2,3-dihydropyrrolo[2,1-b][1,3]oxazol-5-one |
|---|---|
| Synonyms |
(3R-cis)-(-)-2,3-Dihydro-3-isopropyl-7a-methylpyrrolo[2,1-b]oxazol-5(7aH)-one
InChI=1/C10H15NO2/c1-7(2)8-6-13-10(3)5-4-9(12)11(8)10/h4-5,7-8H,6H2,1-3H3/t8-,10-/m0/s MFCD03791043 |
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 315.5ºC at 760 mmHg |
| Melting Point | 47-50ºC(lit.) |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23200 |
| Flash Point | 144.6ºC |
| Exact Mass | 181.11000 |
| PSA | 29.54000 |
| LogP | 1.09370 |
| Vapour Pressure | 0.000435mmHg at 25°C |
| Index of Refraction | 1.53 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |