Oxirane, methyl-, polymer with oxirane, monobis(1-methylpropyl)phenyl ether
Molecular Formula
C14H22O.(C3H6O)n.(C2H4O)x
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.
Chemsrc provides CAS#:69029-39-6 MSDS, density, melting point, boiling point, structure, formula, molecular weight, synthetic route, etc. title: CAS No. 69029-39-6 | Chemsrc address: https://m.chemsrc.com/en/baike/1541152.html