Oxirane, methyl-, polymer with oxirane, monobis(1-methylpropyl)phenyl ether structure
|
Common Name | Oxirane, methyl-, polymer with oxirane, monobis(1-methylpropyl)phenyl ether | ||
---|---|---|---|---|
CAS Number | 69029-39-6 | Molecular Weight | N/A | |
Density | N/A | Boiling Point | N/A | |
Molecular Formula | C14H22O.(C3H6O)n.(C2H4O)x | Melting Point | N/A | |
MSDS | N/A | Flash Point | N/A |
Name | Oxirane, methyl-, polymer with oxirane, monobis(1-methylpropyl)phenyl ether |
---|
Molecular Formula | C14H22O.(C3H6O)n.(C2H4O)x |
---|