| Name |
1-(2-chlorobenzyl)-3-(3,5-dimethylphenyl)tetrahydro-1H-thieno[3,4-d]imidazol-2(3H)-one 5,5-dioxide
|
| Molecular Formula |
C20H21ClN2O3S
|
| Molecular Weight |
404.9
|
| Smiles |
Cc1cc(C)cc(N2C(=O)N(Cc3ccccc3Cl)C3CS(=O)(=O)CC32)c1
|
Cc1cc(C)cc(N2C(=O)N(Cc3ccccc3Cl)C3CS(=O)(=O)CC32)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.