| Name |
4-(2-{[(1,3-dioxo-2-{4-[(E)-phenyldiazenyl]phenyl}-2,3-dihydro-1H-isoindol-5-yl)carbonyl]amino}phenoxy)benzene-1,2-dicarboxylic acid
|
| Molecular Formula |
C35H22N4O8
|
| Molecular Weight |
626.6
|
| Smiles |
O=C(Nc1ccccc1Oc1ccc(C(=O)O)c(C(=O)O)c1)c1ccc2c(c1)C(=O)N(c1ccc(N=Nc3ccccc3)cc1)C2=O
|
O=C(Nc1ccccc1Oc1ccc(C(=O)O)c(C(=O)O)c1)c1ccc2c(c1)C(=O)N(c1ccc(N=Nc3ccccc3)cc1)C2=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.