| Name |
3-tert-butyl-7,9-dimethyl-1-[(naphthalen-1-yl)methyl]-1H,4H,6H,7H,8H,9H-[1,2,4]triazino[4,3-g]purine-6,8-dione
|
| Molecular Formula |
C24H26N6O2
|
| Molecular Weight |
430.5
|
| Smiles |
Cn1c(=O)c2c(nc3n2CC(C(C)(C)C)=NN3Cc2cccc3ccccc23)n(C)c1=O
|
Cn1c(=O)c2c(nc3n2CC(C(C)(C)C)=NN3Cc2cccc3ccccc23)n(C)c1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.