| Name |
ethyl N-(2-{[3-cyano-6-(3,4-dimethoxyphenyl)-4-(trifluoromethyl)-2-pyridinyl]sulfanyl}acetyl)carbamate
|
| Molecular Formula |
C20H18F3N3O5S
|
| Molecular Weight |
469.4
|
| Smiles |
CCOC(=O)NC(=O)CSc1nc(-c2ccc(OC)c(OC)c2)cc(C(F)(F)F)c1C#N
|
CCOC(=O)NC(=O)CSc1nc(-c2ccc(OC)c(OC)c2)cc(C(F)(F)F)c1C#N
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.