| Name |
2-(Methyl{5-[3-(3-thienyl)-1,2,4-oxadiazol-5-yl]pyrimidin-4-yl}amino)ethanol
|
| Molecular Formula |
C13H13N5O2S
|
| Molecular Weight |
303.34
|
| Smiles |
CN(CCO)c1ncncc1-c1nc(-c2ccsc2)no1
|
CN(CCO)c1ncncc1-c1nc(-c2ccsc2)no1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.