| Name |
N-(2-(((8-hydroxy-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)methyl)amino)-2-oxoethyl)benzamide
|
| Molecular Formula |
C15H14N6O3
|
| Molecular Weight |
326.31
|
| Smiles |
O=C(CNC(=O)c1ccccc1)NCc1nnc2c(=O)[nH]ccn12
|
O=C(CNC(=O)c1ccccc1)NCc1nnc2c(=O)[nH]ccn12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.