| Name |
Pyrido[2,3-d]pyrimidine-3(2h)-acetic acid,1,4-dihydro-a-methyl-1-(3-nitrophenyl)-2,4-dioxo-,ethyl ester
|
| Molecular Formula |
C18H16N4O6
|
| Molecular Weight |
384.3
|
| Smiles |
CCOC(=O)C(C)n1c(=O)c2cccnc2n(-c2cccc([N+](=O)[O-])c2)c1=O
|
CCOC(=O)C(C)n1c(=O)c2cccnc2n(-c2cccc([N+](=O)[O-])c2)c1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.