| Name |
(R)-3-(methyl(pyrrolidin-3-yl)amino)benzo[d]isothiazole 1,1-dioxide hydrochloride
|
| Molecular Formula |
C12H16ClN3O2S
|
| Molecular Weight |
301.79
|
| Smiles |
CN(C1=NS(=O)(=O)c2ccccc21)C1CCNC1.Cl
|
CN(C1=NS(=O)(=O)c2ccccc21)C1CCNC1.Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.