| Name | 3',4'-(Methylenedioxy)-2-(1-pyrrolidinyl)butyrophenone-d8 Hydrochloride |
|---|
| Molecular Formula | C15H20ClNO3 |
|---|---|
| Molecular Weight | 305.82 |
| Smiles | CCC(C(=O)c1ccc2c(c1)OCO2)N1CCCC1.Cl |
| Symbol |
GHS02, GHS06, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H301 + H311 + H331-H370 |
| Precautionary Statements | P210-P260-P280-P301 + P310-P311 |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
| Flash Point(F) | 48.2 °F |
| Flash Point(C) | 9 °C |